About 2-(methylamino)acetaldehyde;2-methylpropane;propane
2-(methylamino)acetaldehyde;2-methylpropane;propane (PubChem CID 142611186) has the molecular formula C10H25NO
and a molecular weight of 175.32 g/mol. Its IUPAC name is 2-(methylamino)acetaldehyde;2-methylpropane;propane.
Molecular Properties
| Compound Name | 2-(methylamino)acetaldehyde;2-methylpropane;propane |
| PubChem CID | 142611186 |
| Molecular Formula | C10H25NO |
| Molecular Weight | 175.32 g/mol |
| Exact Mass | 175.19 |
| IUPAC Name | 2-(methylamino)acetaldehyde;2-methylpropane;propane |
| SMILES | CC(C)C.CCC.CNCC=O |
| InChI | InChI=1S/C4H10.C3H7NO.C3H8/c1-4(2)3;1-4-2-3-5;1-3-2/h4H,1-3H3;3-4H,2H2,1H3;3H2,1-2H3 |
| InChIKey | LZWMAXQGAPUHCO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)acetaldehyde;2-methylpropane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)acetaldehyde;2-methylpropane;propane?
The IUPAC name of 2-(methylamino)acetaldehyde;2-methylpropane;propane (CID 142611186) is 2-(methylamino)acetaldehyde;2-methylpropane;propane.
What is the SMILES notation for 2-(methylamino)acetaldehyde;2-methylpropane;propane?
The canonical SMILES for 2-(methylamino)acetaldehyde;2-methylpropane;propane is CC(C)C.CCC.CNCC=O.
What is the InChIKey of 2-(methylamino)acetaldehyde;2-methylpropane;propane?
The InChIKey is LZWMAXQGAPUHCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H7NO.C3H8/c1-4(2)3;1-4-2-3-5;1-3-2/h4H,1-3H3;3-4H,2H2,1H3;3H2,1-2H3.
What are the key properties of 2-(methylamino)acetaldehyde;2-methylpropane;propane?
2-(methylamino)acetaldehyde;2-methylpropane;propane has a molecular weight of 175.32 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)acetaldehyde;2-methylpropane;propane is sourced from PubChem (CID 142611186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).