C8H17NO2 — CID 91339414
2-[(1-hydroxy-3-methylpentan-2-yl)amino]acetaldehyde (PubChem CID 91339414) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-[(1-hydroxy-3-methylpentan-2-yl)amino]acetaldehyde.
| Compound Name | 2-[(1-hydroxy-3-methylpentan-2-yl)amino]acetaldehyde |
|---|---|
| PubChem CID | 91339414 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 2-[(1-hydroxy-3-methylpentan-2-yl)amino]acetaldehyde |
| SMILES | CCC(C)C(CO)NCC=O |
| InChI | InChI=1S/C8H17NO2/c1-3-7(2)8(6-11)9-4-5-10/h5,7-9,11H,3-4,6H2,1-2H3 |
| InChIKey | BSZVRJWLCVVWMP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|