C13H20CuNO3- — CID 6832797
copper;6-[[(1-hydroxy-3-methylpentan-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one;hydroxide (PubChem CID 6832797) has the molecular formula C13H20CuNO3- and a molecular weight of 301.85 g/mol. Its IUPAC name is copper;6-[[(1-hydroxy-3-methylpentan-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one;hydroxide.
| Compound Name | copper;6-[[(1-hydroxy-3-methylpentan-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one;hydroxide |
|---|---|
| PubChem CID | 6832797 |
| Molecular Formula | C13H20CuNO3- |
| Molecular Weight | 301.85 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | copper;6-[[(1-hydroxy-3-methylpentan-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one;hydroxide |
| SMILES | CCC(C)C(CO)NC=C1C=CC=CC1=O.[Cu].[OH-] |
| InChI | InChI=1S/C13H19NO2.Cu.H2O/c1-3-10(2)12(9-15)14-8-11-6-4-5-7-13(11)16;;/h4-8,10,12,14-15H,3,9H2,1-2H3;;1H2/p-1 |
| InChIKey | IELYWKYBUAGIOJ-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 79.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.85 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|