C25H27NO3Sn — CID 11272110
diphenyltin;(2S)-3-methyl-2-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]pentanoic acid (PubChem CID 11272110) has the molecular formula C25H27NO3Sn and a molecular weight of 508.21 g/mol. Its IUPAC name is diphenyltin;(2S)-3-methyl-2-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]pentanoic acid.
| Compound Name | diphenyltin;(2S)-3-methyl-2-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 11272110 |
| Molecular Formula | C25H27NO3Sn |
| Molecular Weight | 508.21 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | diphenyltin;(2S)-3-methyl-2-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]pentanoic acid |
| SMILES | CCC(C)[C@H](N/C=C1\C=CC=CC1=O)C(=O)O.c1ccc([Sn]c2ccccc2)cc1 |
| InChI | InChI=1S/C13H17NO3.2C6H5.Sn/c1-3-9(2)12(13(16)17)14-8-10-6-4-5-7-11(10)15;2*1-2-4-6-5-3-1;/h4-9,12,14H,3H2,1-2H3,(H,16,17);2*1-5H;/b10-8+;;;/t9?,12-;;;/m0.../s1 |
| InChIKey | FODNAGNPWQTLBO-CPOWVLGLSA-N |
| XLogP | 3.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|