C11H23NO3 — CID 177135801
ethane;6-methyl-4-(methylamino)-5-oxoheptanoic acid (PubChem CID 177135801) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is ethane;6-methyl-4-(methylamino)-5-oxoheptanoic acid.
| Compound Name | ethane;6-methyl-4-(methylamino)-5-oxoheptanoic acid |
|---|---|
| PubChem CID | 177135801 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | ethane;6-methyl-4-(methylamino)-5-oxoheptanoic acid |
| SMILES | CC.CNC(CCC(=O)O)C(=O)C(C)C |
| InChI | InChI=1S/C9H17NO3.C2H6/c1-6(2)9(13)7(10-3)4-5-8(11)12;1-2/h6-7,10H,4-5H2,1-3H3,(H,11,12);1-2H3 |
| InChIKey | OFBCXGSOSBCUFF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |