C17H29NO5S — CID 159506357
(4S)-6-methyl-5-oxo-4-[(4-oxo-5-propan-2-ylsulfanylhexanoyl)amino]heptanoic acid (PubChem CID 159506357) has the molecular formula C17H29NO5S and a molecular weight of 359.49 g/mol. Its IUPAC name is (4S)-6-methyl-5-oxo-4-[(4-oxo-5-propan-2-ylsulfanylhexanoyl)amino]heptanoic acid.
| Compound Name | (4S)-6-methyl-5-oxo-4-[(4-oxo-5-propan-2-ylsulfanylhexanoyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 159506357 |
| Molecular Formula | C17H29NO5S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (4S)-6-methyl-5-oxo-4-[(4-oxo-5-propan-2-ylsulfanylhexanoyl)amino]heptanoic acid |
| SMILES | CC(C)SC(C)C(=O)CCC(=O)N[C@@H](CCC(=O)O)C(=O)C(C)C |
| InChI | InChI=1S/C17H29NO5S/c1-10(2)17(23)13(6-9-16(21)22)18-15(20)8-7-14(19)12(5)24-11(3)4/h10-13H,6-9H2,1-5H3,(H,18,20)(H,21,22)/t12?,13-/m0/s1 |
| InChIKey | KUSCWELCAYVHDB-ABLWVSNPSA-N |
| XLogP | 2.44 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |