C14H31N3O4 — CID 145215889
(4R)-5-(2-aminoethylamino)-5-oxo-4-(propanoylamino)pentanoic acid;ethane (PubChem CID 145215889) has the molecular formula C14H31N3O4 and a molecular weight of 305.42 g/mol. Its IUPAC name is (4R)-5-(2-aminoethylamino)-5-oxo-4-(propanoylamino)pentanoic acid;ethane.
| Compound Name | (4R)-5-(2-aminoethylamino)-5-oxo-4-(propanoylamino)pentanoic acid;ethane |
|---|---|
| PubChem CID | 145215889 |
| Molecular Formula | C14H31N3O4 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | (4R)-5-(2-aminoethylamino)-5-oxo-4-(propanoylamino)pentanoic acid;ethane |
| SMILES | CC.CC.CCC(=O)N[C@H](CCC(=O)O)C(=O)NCCN |
| InChI | InChI=1S/C10H19N3O4.2C2H6/c1-2-8(14)13-7(3-4-9(15)16)10(17)12-6-5-11;2*1-2/h7H,2-6,11H2,1H3,(H,12,17)(H,13,14)(H,15,16);2*1-2H3/t7-;;/m1../s1 |
| InChIKey | SFDZZIIICLAGMP-XCUBXKJBSA-N |
| XLogP | 0.87 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |