C5H9NO3S — CID 45040535
2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid (PubChem CID 45040535) has the molecular formula C5H9NO3S and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid.
| Compound Name | 2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 45040535 |
| Molecular Formula | C5H9NO3S |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2-[(3,3,3-trideuterio-2-sulfanylpropanoyl)amino]acetic acid |
| SMILES | [2H]C([2H])([2H])C(S)C(=O)N[13CH2]C(=O)O |
| InChI | InChI=1S/C5H9NO3S/c1-3(10)5(9)6-2-4(7)8/h3,10H,2H2,1H3,(H,6,9)(H,7,8)/i1D3,2+1 |
| InChIKey | YTGJWQPHMWSCST-HZPPXAECSA-N |
| XLogP | -0.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|