C5H8NNaO3S — CID 76968776
sodium 2-[[(2R)-2-sulfanylpropanoyl]amino]acetate (PubChem CID 76968776) has the molecular formula C5H8NNaO3S and a molecular weight of 185.18 g/mol. Its IUPAC name is sodium 2-[[(2R)-2-sulfanylpropanoyl]amino]acetate.
| Compound Name | sodium 2-[[(2R)-2-sulfanylpropanoyl]amino]acetate |
|---|---|
| PubChem CID | 76968776 |
| Molecular Formula | C5H8NNaO3S |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | sodium 2-[[(2R)-2-sulfanylpropanoyl]amino]acetate |
| SMILES | C[C@@H](S)C(=O)NCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H9NO3S.Na/c1-3(10)5(9)6-2-4(7)8;/h3,10H,2H2,1H3,(H,6,9)(H,7,8);/q;+1/p-1/t3-;/m1./s1 |
| InChIKey | BKHJWWRUVITKEE-AENDTGMFSA-M |
| XLogP | -4.83 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|