C5H8NNaO6S2 — CID 23681633
sodium 2-(2-sulfosulfanylpropanoylamino)acetate (PubChem CID 23681633) has the molecular formula C5H8NNaO6S2 and a molecular weight of 265.24 g/mol. Its IUPAC name is sodium 2-(2-sulfosulfanylpropanoylamino)acetate.
| Compound Name | sodium 2-(2-sulfosulfanylpropanoylamino)acetate |
|---|---|
| PubChem CID | 23681633 |
| Molecular Formula | C5H8NNaO6S2 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | sodium 2-(2-sulfosulfanylpropanoylamino)acetate |
| SMILES | CC(SS(=O)(=O)O)C(=O)NCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H9NO6S2.Na/c1-3(13-14(10,11)12)5(9)6-2-4(7)8;/h3H,2H2,1H3,(H,6,9)(H,7,8)(H,10,11,12);/q;+1/p-1 |
| InChIKey | JPNFQHLRXBKLKX-UHFFFAOYSA-M |
| XLogP | -5.22 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | -5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|