C7H15NOS — CID 163905710
(2R)-2,3-dimethyl-N-(sulfanylmethyl)butanamide (PubChem CID 163905710) has the molecular formula C7H15NOS and a molecular weight of 161.27 g/mol. Its IUPAC name is (2R)-2,3-dimethyl-N-(sulfanylmethyl)butanamide.
| Compound Name | (2R)-2,3-dimethyl-N-(sulfanylmethyl)butanamide |
|---|---|
| PubChem CID | 163905710 |
| Molecular Formula | C7H15NOS |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | (2R)-2,3-dimethyl-N-(sulfanylmethyl)butanamide |
| SMILES | CC(C)[C@@H](C)C(=O)NCS |
| InChI | InChI=1S/C7H15NOS/c1-5(2)6(3)7(9)8-4-10/h5-6,10H,4H2,1-3H3,(H,8,9)/t6-/m1/s1 |
| InChIKey | QNSLLHGTQMXHCI-ZCFIWIBFSA-N |
| XLogP | 1.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|