C13H26BrNO — CID 107156655
N-(2-bromo-4,4-dimethylpentyl)-2,3-dimethylbutanamide (PubChem CID 107156655) has the molecular formula C13H26BrNO and a molecular weight of 292.26 g/mol. Its IUPAC name is N-(2-bromo-4,4-dimethylpentyl)-2,3-dimethylbutanamide.
| Compound Name | N-(2-bromo-4,4-dimethylpentyl)-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 107156655 |
| Molecular Formula | C13H26BrNO |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-(2-bromo-4,4-dimethylpentyl)-2,3-dimethylbutanamide |
| SMILES | CC(C)C(C)C(=O)NCC(Br)CC(C)(C)C |
| InChI | InChI=1S/C13H26BrNO/c1-9(2)10(3)12(16)15-8-11(14)7-13(4,5)6/h9-11H,7-8H2,1-6H3,(H,15,16) |
| InChIKey | PWSKSFLAJXMMBL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|