C11H22ClNO — CID 115364703
N-(3-chloro-2,2-dimethylpropyl)-2,3-dimethylbutanamide (PubChem CID 115364703) has the molecular formula C11H22ClNO and a molecular weight of 219.76 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropyl)-2,3-dimethylbutanamide.
| Compound Name | N-(3-chloro-2,2-dimethylpropyl)-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115364703 |
| Molecular Formula | C11H22ClNO |
| Molecular Weight | 219.76 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropyl)-2,3-dimethylbutanamide |
| SMILES | CC(C)C(C)C(=O)NCC(C)(C)CCl |
| InChI | InChI=1S/C11H22ClNO/c1-8(2)9(3)10(14)13-7-11(4,5)6-12/h8-9H,6-7H2,1-5H3,(H,13,14) |
| InChIKey | VZZODVZSFNRBBU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|