C19H36N2O5 — CID 130332966
N-[2,2-dimethyl-3-[2-methyl-3-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl]-2,3-dimethylbutanamide (PubChem CID 130332966) has the molecular formula C19H36N2O5 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-[2-methyl-3-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl]-2,3-dimethylbutanamide.
| Compound Name | N-[2,2-dimethyl-3-[2-methyl-3-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl]-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 130332966 |
| Molecular Formula | C19H36N2O5 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | N-[2,2-dimethyl-3-[2-methyl-3-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl]-2,3-dimethylbutanamide |
| SMILES | CC(CNC(=O)COCC=O)COCC(C)(C)CNC(=O)C(C)C(C)C |
| InChI | InChI=1S/C19H36N2O5/c1-14(2)16(4)18(24)21-12-19(5,6)13-26-10-15(3)9-20-17(23)11-25-8-7-22/h7,14-16H,8-13H2,1-6H3,(H,20,23)(H,21,24) |
| InChIKey | CYCITJOHXQXGOP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|