C13H22N2O5 — CID 170278273
[2-methyl-2-[2-methyl-2-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl] cyanate (PubChem CID 170278273) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is [2-methyl-2-[2-methyl-2-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl] cyanate.
| Compound Name | [2-methyl-2-[2-methyl-2-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl] cyanate |
|---|---|
| PubChem CID | 170278273 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [2-methyl-2-[2-methyl-2-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl] cyanate |
| SMILES | CC(C)(COC(C)(C)COC#N)NC(=O)COCC=O |
| InChI | InChI=1S/C13H22N2O5/c1-12(2,15-11(17)7-18-6-5-16)8-20-13(3,4)9-19-10-14/h5H,6-9H2,1-4H3,(H,15,17) |
| InChIKey | GJJXRWKAQHZPNS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|