C15H34N4O6 — CID 155570253
2-aminooxyacetaldehyde;2-aminooxy-N-[2-[2-methyl-1-[2-methyl-1-(methylamino)propan-2-yl]oxypropan-2-yl]oxyethyl]acetamide (PubChem CID 155570253) has the molecular formula C15H34N4O6 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-aminooxyacetaldehyde;2-aminooxy-N-[2-[2-methyl-1-[2-methyl-1-(methylamino)propan-2-yl]oxypropan-2-yl]oxyethyl]acetamide.
| Compound Name | 2-aminooxyacetaldehyde;2-aminooxy-N-[2-[2-methyl-1-[2-methyl-1-(methylamino)propan-2-yl]oxypropan-2-yl]oxyethyl]acetamide |
|---|---|
| PubChem CID | 155570253 |
| Molecular Formula | C15H34N4O6 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 2-aminooxyacetaldehyde;2-aminooxy-N-[2-[2-methyl-1-[2-methyl-1-(methylamino)propan-2-yl]oxypropan-2-yl]oxyethyl]acetamide |
| SMILES | CNCC(C)(C)OCC(C)(C)OCCNC(=O)CON.NOCC=O |
| InChI | InChI=1S/C13H29N3O4.C2H5NO2/c1-12(2,9-15-5)19-10-13(3,4)18-7-6-16-11(17)8-20-14;3-5-2-1-4/h15H,6-10,14H2,1-5H3,(H,16,17);1H,2-3H2 |
| InChIKey | PFAHCJJLMCPHCJ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|