C12H23NO5 — CID 172626027
2-butoxy-N-[2-[2-(2-oxoethoxy)ethoxy]ethyl]acetamide (PubChem CID 172626027) has the molecular formula C12H23NO5 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-butoxy-N-[2-[2-(2-oxoethoxy)ethoxy]ethyl]acetamide.
| Compound Name | 2-butoxy-N-[2-[2-(2-oxoethoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 172626027 |
| Molecular Formula | C12H23NO5 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-butoxy-N-[2-[2-(2-oxoethoxy)ethoxy]ethyl]acetamide |
| SMILES | CCCCOCC(=O)NCCOCCOCC=O |
| InChI | InChI=1S/C12H23NO5/c1-2-3-6-18-11-12(15)13-4-7-16-9-10-17-8-5-14/h5H,2-4,6-11H2,1H3,(H,13,15) |
| InChIKey | PPFOXFHBHOUBEG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|