C19H35N3O10 — CID 142338805
2-acetamidoacetic acid;N-[2-[2-[2-oxo-2-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 142338805) has the molecular formula C19H35N3O10 and a molecular weight of 465.50 g/mol. Its IUPAC name is 2-acetamidoacetic acid;N-[2-[2-[2-oxo-2-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2-acetamidoacetic acid;N-[2-[2-[2-oxo-2-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 142338805 |
| Molecular Formula | C19H35N3O10 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 2-acetamidoacetic acid;N-[2-[2-[2-oxo-2-[2-[2-(2-oxoethoxy)ethoxy]ethylamino]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(=O)NCC(=O)O.CCC(=O)NCCOCCOCC(=O)NCCOCCOCC=O |
| InChI | InChI=1S/C15H28N2O7.C4H7NO3/c1-2-14(19)16-3-6-22-11-12-24-13-15(20)17-4-7-21-9-10-23-8-5-18;1-3(6)5-2-4(7)8/h5H,2-4,6-13H2,1H3,(H,16,19)(H,17,20);2H2,1H3,(H,5,6)(H,7,8) |
| InChIKey | WOKYAZPYLRSHNP-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 178.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|