C13H26N2O5 — CID 176675274
2-[2-[[2-(3-amino-3-methylbutoxy)-2-methylpropyl]amino]-2-oxoethoxy]acetic acid (PubChem CID 176675274) has the molecular formula C13H26N2O5 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[2-[[2-(3-amino-3-methylbutoxy)-2-methylpropyl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[2-(3-amino-3-methylbutoxy)-2-methylpropyl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 176675274 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-[2-[[2-(3-amino-3-methylbutoxy)-2-methylpropyl]amino]-2-oxoethoxy]acetic acid |
| SMILES | CC(C)(N)CCOC(C)(C)CNC(=O)COCC(=O)O |
| InChI | InChI=1S/C13H26N2O5/c1-12(2,14)5-6-20-13(3,4)9-15-10(16)7-19-8-11(17)18/h5-9,14H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | JOUWJPSKGJFBHU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |