C9H17NO6S — CID 79558619
2-[2-[(2-methyl-2-methylsulfonylpropyl)amino]-2-oxoethoxy]acetic acid (PubChem CID 79558619) has the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-[2-[(2-methyl-2-methylsulfonylpropyl)amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(2-methyl-2-methylsulfonylpropyl)amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 79558619 |
| Molecular Formula | C9H17NO6S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-[2-[(2-methyl-2-methylsulfonylpropyl)amino]-2-oxoethoxy]acetic acid |
| SMILES | CC(C)(CNC(=O)COCC(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C9H17NO6S/c1-9(2,17(3,14)15)6-10-7(11)4-16-5-8(12)13/h4-6H2,1-3H3,(H,10,11)(H,12,13) |
| InChIKey | MNMVKMVSFHPBCN-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |