C11H22N2O5S — CID 79556227
4-[(2-methyl-2-methylsulfonylpropyl)carbamoylamino]pentanoic acid (PubChem CID 79556227) has the molecular formula C11H22N2O5S and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-[(2-methyl-2-methylsulfonylpropyl)carbamoylamino]pentanoic acid.
| Compound Name | 4-[(2-methyl-2-methylsulfonylpropyl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 79556227 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-[(2-methyl-2-methylsulfonylpropyl)carbamoylamino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)NCC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H22N2O5S/c1-8(5-6-9(14)15)13-10(16)12-7-11(2,3)19(4,17)18/h8H,5-7H2,1-4H3,(H,14,15)(H2,12,13,16) |
| InChIKey | FSJNBAAMPZKPAR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |