C12H24N2O5S — CID 81072041
3-[[(2-methyl-2-methylsulfonylpropyl)carbamoylamino]methyl]pentanoic acid (PubChem CID 81072041) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-[[(2-methyl-2-methylsulfonylpropyl)carbamoylamino]methyl]pentanoic acid.
| Compound Name | 3-[[(2-methyl-2-methylsulfonylpropyl)carbamoylamino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 81072041 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-[[(2-methyl-2-methylsulfonylpropyl)carbamoylamino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)NCC(C)(C)S(C)(=O)=O)CC(=O)O |
| InChI | InChI=1S/C12H24N2O5S/c1-5-9(6-10(15)16)7-13-11(17)14-8-12(2,3)20(4,18)19/h9H,5-8H2,1-4H3,(H,15,16)(H2,13,14,17) |
| InChIKey | BSFHPEGWAUPOSM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |