C10H16F4N2O3 — CID 106294846
5-(2,2,3,3-tetrafluoropropylcarbamoylamino)hexanoic acid (PubChem CID 106294846) has the molecular formula C10H16F4N2O3 and a molecular weight of 288.24 g/mol. Its IUPAC name is 5-(2,2,3,3-tetrafluoropropylcarbamoylamino)hexanoic acid.
| Compound Name | 5-(2,2,3,3-tetrafluoropropylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 106294846 |
| Molecular Formula | C10H16F4N2O3 |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 5-(2,2,3,3-tetrafluoropropylcarbamoylamino)hexanoic acid |
| SMILES | CC(CCCC(=O)O)NC(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H16F4N2O3/c1-6(3-2-4-7(17)18)16-9(19)15-5-10(13,14)8(11)12/h6,8H,2-5H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | IUELEKDTVKVWQR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|