C10H16F4N2O4 — CID 106295178
5-methoxy-2-(2,2,3,3-tetrafluoropropylcarbamoylamino)pentanoic acid (PubChem CID 106295178) has the molecular formula C10H16F4N2O4 and a molecular weight of 304.24 g/mol. Its IUPAC name is 5-methoxy-2-(2,2,3,3-tetrafluoropropylcarbamoylamino)pentanoic acid.
| Compound Name | 5-methoxy-2-(2,2,3,3-tetrafluoropropylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 106295178 |
| Molecular Formula | C10H16F4N2O4 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 5-methoxy-2-(2,2,3,3-tetrafluoropropylcarbamoylamino)pentanoic acid |
| SMILES | COCCCC(NC(=O)NCC(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C10H16F4N2O4/c1-20-4-2-3-6(7(17)18)16-9(19)15-5-10(13,14)8(11)12/h6,8H,2-5H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | IBJWXVUYZIGFRZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|