C13H26N2O4 — CID 115432700
2-[[2-(aminomethyl)-2-ethylbutanoyl]amino]-5-methoxypentanoic acid (PubChem CID 115432700) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[[2-(aminomethyl)-2-ethylbutanoyl]amino]-5-methoxypentanoic acid.
| Compound Name | 2-[[2-(aminomethyl)-2-ethylbutanoyl]amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 115432700 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-[[2-(aminomethyl)-2-ethylbutanoyl]amino]-5-methoxypentanoic acid |
| SMILES | CCC(CC)(CN)C(=O)NC(CCCOC)C(=O)O |
| InChI | InChI=1S/C13H26N2O4/c1-4-13(5-2,9-14)12(18)15-10(11(16)17)7-6-8-19-3/h10H,4-9,14H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | CUOXHMGHAULAPF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|