C11H19F3N2O5 — CID 81085400
5-methoxy-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid (PubChem CID 81085400) has the molecular formula C11H19F3N2O5 and a molecular weight of 316.28 g/mol. Its IUPAC name is 5-methoxy-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid.
| Compound Name | 5-methoxy-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 81085400 |
| Molecular Formula | C11H19F3N2O5 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 5-methoxy-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid |
| SMILES | COCCCC(NC(=O)NCCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H19F3N2O5/c1-20-5-2-3-8(9(17)18)16-10(19)15-4-6-21-7-11(12,13)14/h8H,2-7H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | XLUFVMUECLGDLL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|