C10H17F3N2O4 — CID 107567023
(2R)-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid (PubChem CID 107567023) has the molecular formula C10H17F3N2O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is (2R)-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid.
| Compound Name | (2R)-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107567023 |
| Molecular Formula | C10H17F3N2O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2R)-2-[2-(2,2,2-trifluoroethoxy)ethylcarbamoylamino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)NCCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H17F3N2O4/c1-2-3-7(8(16)17)15-9(18)14-4-5-19-6-10(11,12)13/h7H,2-6H2,1H3,(H,16,17)(H2,14,15,18)/t7-/m1/s1 |
| InChIKey | FPRAPVPGNCHWSB-SSDOTTSWSA-N |
| XLogP | 1.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|