C10H21N3O6S — CID 106340722
5-methoxy-2-[2-(methylsulfamoyl)ethylcarbamoylamino]pentanoic acid (PubChem CID 106340722) has the molecular formula C10H21N3O6S and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-methoxy-2-[2-(methylsulfamoyl)ethylcarbamoylamino]pentanoic acid.
| Compound Name | 5-methoxy-2-[2-(methylsulfamoyl)ethylcarbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 106340722 |
| Molecular Formula | C10H21N3O6S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 5-methoxy-2-[2-(methylsulfamoyl)ethylcarbamoylamino]pentanoic acid |
| SMILES | CNS(=O)(=O)CCNC(=O)NC(CCCOC)C(=O)O |
| InChI | InChI=1S/C10H21N3O6S/c1-11-20(17,18)7-5-12-10(16)13-8(9(14)15)4-3-6-19-2/h8,11H,3-7H2,1-2H3,(H,14,15)(H2,12,13,16) |
| InChIKey | QRYPMNKFUHLNBV-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|