C12H26N2O3S — CID 79550577
7-amino-N-(2-methyl-2-methylsulfonylpropyl)heptanamide (PubChem CID 79550577) has the molecular formula C12H26N2O3S and a molecular weight of 278.42 g/mol. Its IUPAC name is 7-amino-N-(2-methyl-2-methylsulfonylpropyl)heptanamide.
| Compound Name | 7-amino-N-(2-methyl-2-methylsulfonylpropyl)heptanamide |
|---|---|
| PubChem CID | 79550577 |
| Molecular Formula | C12H26N2O3S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 7-amino-N-(2-methyl-2-methylsulfonylpropyl)heptanamide |
| SMILES | CC(C)(CNC(=O)CCCCCCN)S(C)(=O)=O |
| InChI | InChI=1S/C12H26N2O3S/c1-12(2,18(3,16)17)10-14-11(15)8-6-4-5-7-9-13/h4-10,13H2,1-3H3,(H,14,15) |
| InChIKey | MNYUWBASINGNBM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|