C11H20F3N3O2 — CID 119737403
7-amino-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]heptanamide (PubChem CID 119737403) has the molecular formula C11H20F3N3O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 7-amino-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]heptanamide.
| Compound Name | 7-amino-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]heptanamide |
|---|---|
| PubChem CID | 119737403 |
| Molecular Formula | C11H20F3N3O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 7-amino-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]heptanamide |
| SMILES | NCCCCCCC(=O)NCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H20F3N3O2/c12-11(13,14)8-17-10(19)7-16-9(18)5-3-1-2-4-6-15/h1-8,15H2,(H,16,18)(H,17,19) |
| InChIKey | OHEAQBMJUHPXJE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|