C15H29NO5 — CID 171795100
2-[2-[[2-methyl-4-(2-methylpentan-2-yloxy)butyl]amino]-2-oxoethoxy]acetic acid (PubChem CID 171795100) has the molecular formula C15H29NO5 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-[2-[[2-methyl-4-(2-methylpentan-2-yloxy)butyl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[2-methyl-4-(2-methylpentan-2-yloxy)butyl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 171795100 |
| Molecular Formula | C15H29NO5 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2-[2-[[2-methyl-4-(2-methylpentan-2-yloxy)butyl]amino]-2-oxoethoxy]acetic acid |
| SMILES | CCCC(C)(C)OCCC(C)CNC(=O)COCC(=O)O |
| InChI | InChI=1S/C15H29NO5/c1-5-7-15(3,4)21-8-6-12(2)9-16-13(17)10-20-11-14(18)19/h12H,5-11H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | FSJQZWRZVMFUFU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |