C11H22N2O4 — CID 61328234
2-[2-[[2-(dimethylamino)-3-methylbutyl]amino]-2-oxoethoxy]acetic acid (PubChem CID 61328234) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[2-[[2-(dimethylamino)-3-methylbutyl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[2-(dimethylamino)-3-methylbutyl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61328234 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[2-[[2-(dimethylamino)-3-methylbutyl]amino]-2-oxoethoxy]acetic acid |
| SMILES | CC(C)C(CNC(=O)COCC(=O)O)N(C)C |
| InChI | InChI=1S/C11H22N2O4/c1-8(2)9(13(3)4)5-12-10(14)6-17-7-11(15)16/h8-9H,5-7H2,1-4H3,(H,12,14)(H,15,16) |
| InChIKey | DZPUYEFHYSIIAK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |