C10H20N2O5 — CID 62842947
2-[2-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-oxoethoxy]acetic acid (PubChem CID 62842947) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[2-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 62842947 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-[2-[2-[2-methoxyethyl(methyl)amino]ethylamino]-2-oxoethoxy]acetic acid |
| SMILES | COCCN(C)CCNC(=O)COCC(=O)O |
| InChI | InChI=1S/C10H20N2O5/c1-12(5-6-16-2)4-3-11-9(13)7-17-8-10(14)15/h3-8H2,1-2H3,(H,11,13)(H,14,15) |
| InChIKey | BWWKHPAZBHOCRP-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |