C9H18ClN3O3 — CID 62848521
2-chloro-N-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoyl]acetamide (PubChem CID 62848521) has the molecular formula C9H18ClN3O3 and a molecular weight of 251.71 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoyl]acetamide.
| Compound Name | 2-chloro-N-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoyl]acetamide |
|---|---|
| PubChem CID | 62848521 |
| Molecular Formula | C9H18ClN3O3 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-chloro-N-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoyl]acetamide |
| SMILES | COCCN(C)CCNC(=O)NC(=O)CCl |
| InChI | InChI=1S/C9H18ClN3O3/c1-13(5-6-16-2)4-3-11-9(15)12-8(14)7-10/h3-7H2,1-2H3,(H2,11,12,14,15) |
| InChIKey | IRSDUHWOEORTGC-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|