C11H23N3O4 — CID 62851170
ethyl 2-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoylamino]acetate (PubChem CID 62851170) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl 2-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 62851170 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethyl 2-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCCN(C)CCOC |
| InChI | InChI=1S/C11H23N3O4/c1-4-18-10(15)9-13-11(16)12-5-6-14(2)7-8-17-3/h4-9H2,1-3H3,(H2,12,13,16) |
| InChIKey | YNJAOZQPTZEQPT-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |