C11H23N3O4 — CID 55126918
4-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoylamino]butanoic acid (PubChem CID 55126918) has the molecular formula C11H23N3O4 and a molecular weight of 261.32 g/mol. Its IUPAC name is 4-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoylamino]butanoic acid.
| Compound Name | 4-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 55126918 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 4-[2-[2-methoxyethyl(methyl)amino]ethylcarbamoylamino]butanoic acid |
| SMILES | COCCN(C)CCNC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C11H23N3O4/c1-14(8-9-18-2)7-6-13-11(17)12-5-3-4-10(15)16/h3-9H2,1-2H3,(H,15,16)(H2,12,13,17) |
| InChIKey | JXMQUSXLVAFYRM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|