C12H26N4O3 — CID 55127056
N-(ethylcarbamoyl)-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]propanamide (PubChem CID 55127056) has the molecular formula C12H26N4O3 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]propanamide.
| Compound Name | N-(ethylcarbamoyl)-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]propanamide |
|---|---|
| PubChem CID | 55127056 |
| Molecular Formula | C12H26N4O3 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[2-[2-methoxyethyl(methyl)amino]ethylamino]propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)NCCN(C)CCOC |
| InChI | InChI=1S/C12H26N4O3/c1-5-13-12(18)15-11(17)10(2)14-6-7-16(3)8-9-19-4/h10,14H,5-9H2,1-4H3,(H2,13,15,17,18) |
| InChIKey | CQMJOINJKUOCRN-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |