C10H21N3O4 — CID 106190668
N-(ethylcarbamoyl)-2-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanamide (PubChem CID 106190668) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanamide.
| Compound Name | N-(ethylcarbamoyl)-2-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 106190668 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)NC(CO)COC |
| InChI | InChI=1S/C10H21N3O4/c1-4-11-10(16)13-9(15)7(2)12-8(5-14)6-17-3/h7-8,12,14H,4-6H2,1-3H3,(H2,11,13,15,16) |
| InChIKey | JEWLSADCEPVIAO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |