C7H17N3O3 — CID 106189728
N'-hydroxy-2-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanimidamide (PubChem CID 106189728) has the molecular formula C7H17N3O3 and a molecular weight of 191.23 g/mol. Its IUPAC name is N'-hydroxy-2-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanimidamide.
| Compound Name | N'-hydroxy-2-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanimidamide |
|---|---|
| PubChem CID | 106189728 |
| Molecular Formula | C7H17N3O3 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N'-hydroxy-2-[(1-hydroxy-3-methoxypropan-2-yl)amino]propanimidamide |
| SMILES | COCC(CO)NC(C)C(N)=NO |
| InChI | InChI=1S/C7H17N3O3/c1-5(7(8)10-12)9-6(3-11)4-13-2/h5-6,9,11-12H,3-4H2,1-2H3,(H2,8,10) |
| InChIKey | NCOLGAVVEUWLOM-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|