C8H18N2O3 — CID 106190418
2-[(1-hydroxy-3-methoxypropan-2-yl)amino]-N-methylpropanamide (PubChem CID 106190418) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-[(1-hydroxy-3-methoxypropan-2-yl)amino]-N-methylpropanamide.
| Compound Name | 2-[(1-hydroxy-3-methoxypropan-2-yl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 106190418 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 2-[(1-hydroxy-3-methoxypropan-2-yl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NC(CO)COC |
| InChI | InChI=1S/C8H18N2O3/c1-6(8(12)9-2)10-7(4-11)5-13-3/h6-7,10-11H,4-5H2,1-3H3,(H,9,12) |
| InChIKey | RSWLPQKLHUWKIK-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |