C9H19N3O4 — CID 66171216
2-(2,3-dihydroxypropylamino)-N-(ethylcarbamoyl)propanamide (PubChem CID 66171216) has the molecular formula C9H19N3O4 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-(2,3-dihydroxypropylamino)-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 66171216 |
| Molecular Formula | C9H19N3O4 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)NCC(O)CO |
| InChI | InChI=1S/C9H19N3O4/c1-3-10-9(16)12-8(15)6(2)11-4-7(14)5-13/h6-7,11,13-14H,3-5H2,1-2H3,(H2,10,12,15,16) |
| InChIKey | OGYDBIKEDZKYDS-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |