C9H20N2O3 — CID 66169110
2-(2,3-dihydroxypropylamino)-N-propan-2-ylpropanamide (PubChem CID 66169110) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-N-propan-2-ylpropanamide.
| Compound Name | 2-(2,3-dihydroxypropylamino)-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 66169110 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)NCC(O)CO |
| InChI | InChI=1S/C9H20N2O3/c1-6(2)11-9(14)7(3)10-4-8(13)5-12/h6-8,10,12-13H,4-5H2,1-3H3,(H,11,14) |
| InChIKey | FIFLLXNOJXNIPX-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |