C12H26N4O2 — CID 43083312
2-[2-(diethylamino)ethylamino]-N-(ethylcarbamoyl)propanamide (PubChem CID 43083312) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-[2-(diethylamino)ethylamino]-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 43083312 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)NCCN(CC)CC |
| InChI | InChI=1S/C12H26N4O2/c1-5-13-12(18)15-11(17)10(4)14-8-9-16(6-2)7-3/h10,14H,5-9H2,1-4H3,(H2,13,15,17,18) |
| InChIKey | BMGSNIXKQNFYIC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |