C15H32N4O2 — CID 43083671
2-[5-(diethylamino)pentan-2-ylamino]-N-(ethylcarbamoyl)propanamide (PubChem CID 43083671) has the molecular formula C15H32N4O2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 2-[5-(diethylamino)pentan-2-ylamino]-N-(ethylcarbamoyl)propanamide.
| Compound Name | 2-[5-(diethylamino)pentan-2-ylamino]-N-(ethylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 43083671 |
| Molecular Formula | C15H32N4O2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 2-[5-(diethylamino)pentan-2-ylamino]-N-(ethylcarbamoyl)propanamide |
| SMILES | CCNC(=O)NC(=O)C(C)NC(C)CCCN(CC)CC |
| InChI | InChI=1S/C15H32N4O2/c1-6-16-15(21)18-14(20)13(5)17-12(4)10-9-11-19(7-2)8-3/h12-13,17H,6-11H2,1-5H3,(H2,16,18,20,21) |
| InChIKey | GNBNMXOBFHKIGT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |