C9H17NO5 — CID 79254836
2-[2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-2-oxoethoxy]acetic acid (PubChem CID 79254836) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-[2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 79254836 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 2-[2-[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]-2-oxoethoxy]acetic acid |
| SMILES | CC(C)[C@@H](CO)NC(=O)COCC(=O)O |
| InChI | InChI=1S/C9H17NO5/c1-6(2)7(3-11)10-8(12)4-15-5-9(13)14/h6-7,11H,3-5H2,1-2H3,(H,10,12)(H,13,14)/t7-/m1/s1 |
| InChIKey | FCHQWRLCZDJMML-SSDOTTSWSA-N |
| XLogP | -0.78 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |