C10H21NO4 — CID 79255861
N-(1-hydroxy-3-methylbutan-2-yl)-2-(2-methoxyethoxy)acetamide (PubChem CID 79255861) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylbutan-2-yl)-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-(1-hydroxy-3-methylbutan-2-yl)-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 79255861 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | N-(1-hydroxy-3-methylbutan-2-yl)-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NC(CO)C(C)C |
| InChI | InChI=1S/C10H21NO4/c1-8(2)9(6-12)11-10(13)7-15-5-4-14-3/h8-9,12H,4-7H2,1-3H3,(H,11,13) |
| InChIKey | JUCRDGDVKNZSME-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|