C12H21N3O7 — CID 163570676
2-[2-oxo-2-[2-[[2-(propan-2-yloxycarbonylamino)acetyl]amino]ethylamino]ethoxy]acetic acid (PubChem CID 163570676) has the molecular formula C12H21N3O7 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2-[2-oxo-2-[2-[[2-(propan-2-yloxycarbonylamino)acetyl]amino]ethylamino]ethoxy]acetic acid.
| Compound Name | 2-[2-oxo-2-[2-[[2-(propan-2-yloxycarbonylamino)acetyl]amino]ethylamino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 163570676 |
| Molecular Formula | C12H21N3O7 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[2-oxo-2-[2-[[2-(propan-2-yloxycarbonylamino)acetyl]amino]ethylamino]ethoxy]acetic acid |
| SMILES | CC(C)OC(=O)NCC(=O)NCCNC(=O)COCC(=O)O |
| InChI | InChI=1S/C12H21N3O7/c1-8(2)22-12(20)15-5-9(16)13-3-4-14-10(17)6-21-7-11(18)19/h8H,3-7H2,1-2H3,(H,13,16)(H,14,17)(H,15,20)(H,18,19) |
| InChIKey | FZBFBNVLSSLMSM-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|