C16H25N5O5 — CID 170273502
[1-[2-methyl-2-[2-methyl-2-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl]triazol-4-yl]methyl cyanate (PubChem CID 170273502) has the molecular formula C16H25N5O5 and a molecular weight of 367.41 g/mol. Its IUPAC name is [1-[2-methyl-2-[2-methyl-2-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl]triazol-4-yl]methyl cyanate.
| Compound Name | [1-[2-methyl-2-[2-methyl-2-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl]triazol-4-yl]methyl cyanate |
|---|---|
| PubChem CID | 170273502 |
| Molecular Formula | C16H25N5O5 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [1-[2-methyl-2-[2-methyl-2-[[2-(2-oxoethoxy)acetyl]amino]propoxy]propyl]triazol-4-yl]methyl cyanate |
| SMILES | CC(C)(COC(C)(C)Cn1cc(COC#N)nn1)NC(=O)COCC=O |
| InChI | InChI=1S/C16H25N5O5/c1-15(2,18-14(23)9-24-6-5-22)11-26-16(3,4)10-21-7-13(19-20-21)8-25-12-17/h5,7H,6,8-11H2,1-4H3,(H,18,23) |
| InChIKey | SICKUYYQYBGNAE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 128.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|