C21H34N6O3 — CID 168842019
1-[4-[2-[[1-(3,3-dimethyl-2-methylidenebutyl)triazol-4-yl]methoxy]ethoxymethyl]triazol-1-yl]-3,3-dimethylbutan-2-one (PubChem CID 168842019) has the molecular formula C21H34N6O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-[4-[2-[[1-(3,3-dimethyl-2-methylidenebutyl)triazol-4-yl]methoxy]ethoxymethyl]triazol-1-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[4-[2-[[1-(3,3-dimethyl-2-methylidenebutyl)triazol-4-yl]methoxy]ethoxymethyl]triazol-1-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 168842019 |
| Molecular Formula | C21H34N6O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 1-[4-[2-[[1-(3,3-dimethyl-2-methylidenebutyl)triazol-4-yl]methoxy]ethoxymethyl]triazol-1-yl]-3,3-dimethylbutan-2-one |
| SMILES | C=C(Cn1cc(COCCOCc2cn(CC(=O)C(C)(C)C)nn2)nn1)C(C)(C)C |
| InChI | InChI=1S/C21H34N6O3/c1-16(20(2,3)4)10-26-11-17(22-24-26)14-29-8-9-30-15-18-12-27(25-23-18)13-19(28)21(5,6)7/h11-12H,1,8-10,13-15H2,2-7H3 |
| InChIKey | QSUKOHHFMSGBIE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|