C32H54N5O12P — CID 162478351
N-[(E)-benzylideneamino]-2-[4-[2-[2-[2-[2-[2-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]triazol-1-yl]acetamide (PubChem CID 162478351) has the molecular formula C32H54N5O12P and a molecular weight of 731.78 g/mol. Its IUPAC name is N-[(E)-benzylideneamino]-2-[4-[2-[2-[2-[2-[2-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]triazol-1-yl]acetamide.
| Compound Name | N-[(E)-benzylideneamino]-2-[4-[2-[2-[2-[2-[2-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 162478351 |
| Molecular Formula | C32H54N5O12P |
| Molecular Weight | 731.78 g/mol |
| Exact Mass | 731.35 |
| IUPAC Name | N-[(E)-benzylideneamino]-2-[4-[2-[2-[2-[2-[2-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethyl]triazol-1-yl]acetamide |
| SMILES | CCOP(=O)(CCOCCOCCOCCOCCOCCOCCOCCOCc1cn(CC(=O)N/N=C/c2ccccc2)nn1)OCC |
| InChI | InChI=1S/C32H54N5O12P/c1-3-48-50(39,49-4-2)25-24-46-21-20-44-17-16-42-13-12-40-10-11-41-14-15-43-18-19-45-22-23-47-29-31-27-37(36-34-31)28-32(38)35-33-26-30-8-6-5-7-9-30/h5-9,26-27H,3-4,10-25,28-29H2,1-2H3,(H,35,38)/b33-26+ |
| InChIKey | FLFSLEXQKUCYNH-MHTZHOPKSA-N |
| XLogP | 2.33 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.78 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|